About 4-(4,4,4-trifluorobutyl)cyclohex-3-en-1-one
4-(4,4,4-trifluorobutyl)cyclohex-3-en-1-one (PubChem CID 83261111) has the molecular formula C10H13F3O
and a molecular weight of 206.21 g/mol. Its IUPAC name is 4-(4,4,4-trifluorobutyl)cyclohex-3-en-1-one.
Molecular Properties
| Compound Name | 4-(4,4,4-trifluorobutyl)cyclohex-3-en-1-one |
| PubChem CID | 83261111 |
| Molecular Formula | C10H13F3O |
| Molecular Weight | 206.21 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 4-(4,4,4-trifluorobutyl)cyclohex-3-en-1-one |
| SMILES | O=C1CC=C(CCCC(F)(F)F)CC1 |
| InChI | InChI=1S/C10H13F3O/c11-10(12,13)7-1-2-8-3-5-9(14)6-4-8/h3H,1-2,4-7H2 |
| InChIKey | CXSHQQVLYYYDCG-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.21 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-(4,4,4-trifluorobutyl)cyclohex-3-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4,4,4-trifluorobutyl)cyclohex-3-en-1-one?
The IUPAC name of 4-(4,4,4-trifluorobutyl)cyclohex-3-en-1-one (CID 83261111) is 4-(4,4,4-trifluorobutyl)cyclohex-3-en-1-one.
What is the SMILES notation for 4-(4,4,4-trifluorobutyl)cyclohex-3-en-1-one?
The canonical SMILES for 4-(4,4,4-trifluorobutyl)cyclohex-3-en-1-one is O=C1CC=C(CCCC(F)(F)F)CC1.
What is the InChIKey of 4-(4,4,4-trifluorobutyl)cyclohex-3-en-1-one?
The InChIKey is CXSHQQVLYYYDCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13F3O/c11-10(12,13)7-1-2-8-3-5-9(14)6-4-8/h3H,1-2,4-7H2.
What are the key properties of 4-(4,4,4-trifluorobutyl)cyclohex-3-en-1-one?
4-(4,4,4-trifluorobutyl)cyclohex-3-en-1-one has a molecular weight of 206.21 g/mol, XLogP of 3.40, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4,4,4-trifluorobutyl)cyclohex-3-en-1-one is sourced from PubChem (CID 83261111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).