About 3-(2-chloroethyl)-2,4-dihydrochromene-3-carbonitrile
3-(2-chloroethyl)-2,4-dihydrochromene-3-carbonitrile (PubChem CID 83261180) has the molecular formula C12H12ClNO
and a molecular weight of 221.69 g/mol. Its IUPAC name is 3-(2-chloroethyl)-2,4-dihydrochromene-3-carbonitrile.
Molecular Properties
| Compound Name | 3-(2-chloroethyl)-2,4-dihydrochromene-3-carbonitrile |
| PubChem CID | 83261180 |
| Molecular Formula | C12H12ClNO |
| Molecular Weight | 221.69 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | 3-(2-chloroethyl)-2,4-dihydrochromene-3-carbonitrile |
| SMILES | N#CC1(CCCl)COc2ccccc2C1 |
| InChI | InChI=1S/C12H12ClNO/c13-6-5-12(8-14)7-10-3-1-2-4-11(10)15-9-12/h1-4H,5-7,9H2 |
| InChIKey | UEIVVJXORXEQAA-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.69 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-chloroethyl)-2,4-dihydrochromene-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-chloroethyl)-2,4-dihydrochromene-3-carbonitrile?
The IUPAC name of 3-(2-chloroethyl)-2,4-dihydrochromene-3-carbonitrile (CID 83261180) is 3-(2-chloroethyl)-2,4-dihydrochromene-3-carbonitrile.
What is the SMILES notation for 3-(2-chloroethyl)-2,4-dihydrochromene-3-carbonitrile?
The canonical SMILES for 3-(2-chloroethyl)-2,4-dihydrochromene-3-carbonitrile is N#CC1(CCCl)COc2ccccc2C1.
What is the InChIKey of 3-(2-chloroethyl)-2,4-dihydrochromene-3-carbonitrile?
The InChIKey is UEIVVJXORXEQAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12ClNO/c13-6-5-12(8-14)7-10-3-1-2-4-11(10)15-9-12/h1-4H,5-7,9H2.
What are the key properties of 3-(2-chloroethyl)-2,4-dihydrochromene-3-carbonitrile?
3-(2-chloroethyl)-2,4-dihydrochromene-3-carbonitrile has a molecular weight of 221.69 g/mol, XLogP of 2.76, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-chloroethyl)-2,4-dihydrochromene-3-carbonitrile is sourced from PubChem (CID 83261180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).