C13H13FO2 — CID 83261329
4-(5-fluoro-2-methoxyphenyl)cyclohex-3-en-1-one (PubChem CID 83261329) has the molecular formula C13H13FO2 and a molecular weight of 220.24 g/mol. Its IUPAC name is 4-(5-fluoro-2-methoxyphenyl)cyclohex-3-en-1-one.
| Compound Name | 4-(5-fluoro-2-methoxyphenyl)cyclohex-3-en-1-one |
|---|---|
| PubChem CID | 83261329 |
| Molecular Formula | C13H13FO2 |
| Molecular Weight | 220.24 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | 4-(5-fluoro-2-methoxyphenyl)cyclohex-3-en-1-one |
| SMILES | COc1ccc(F)cc1C1=CCC(=O)CC1 |
| InChI | InChI=1S/C13H13FO2/c1-16-13-7-4-10(14)8-12(13)9-2-5-11(15)6-3-9/h2,4,7-8H,3,5-6H2,1H3 |
| InChIKey | KBPDOTYIGZWRBN-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.24 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |