About 4-prop-1-en-2-ylazepane
4-prop-1-en-2-ylazepane (PubChem CID 83262018) has the molecular formula C9H17N
and a molecular weight of 139.24 g/mol. Its IUPAC name is 4-prop-1-en-2-ylazepane.
Molecular Properties
| Compound Name | 4-prop-1-en-2-ylazepane |
| PubChem CID | 83262018 |
| Molecular Formula | C9H17N |
| Molecular Weight | 139.24 g/mol |
| Exact Mass | 139.14 |
| IUPAC Name | 4-prop-1-en-2-ylazepane |
| SMILES | C=C(C)C1CCCNCC1 |
| InChI | InChI=1S/C9H17N/c1-8(2)9-4-3-6-10-7-5-9/h9-10H,1,3-7H2,2H3 |
| InChIKey | ULHBFSXAWWZLOY-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.24 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-prop-1-en-2-ylazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-prop-1-en-2-ylazepane?
The IUPAC name of 4-prop-1-en-2-ylazepane (CID 83262018) is 4-prop-1-en-2-ylazepane.
What is the SMILES notation for 4-prop-1-en-2-ylazepane?
The canonical SMILES for 4-prop-1-en-2-ylazepane is C=C(C)C1CCCNCC1.
What is the InChIKey of 4-prop-1-en-2-ylazepane?
The InChIKey is ULHBFSXAWWZLOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N/c1-8(2)9-4-3-6-10-7-5-9/h9-10H,1,3-7H2,2H3.
What are the key properties of 4-prop-1-en-2-ylazepane?
4-prop-1-en-2-ylazepane has a molecular weight of 139.24 g/mol, XLogP of 1.95, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-prop-1-en-2-ylazepane is sourced from PubChem (CID 83262018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).