C10H18F3N3O2 — CID 83262048
N,N-dimethyl-4-(2,2,2-trifluoroethoxyamino)piperidine-1-carboxamide (PubChem CID 83262048) has the molecular formula C10H18F3N3O2 and a molecular weight of 269.27 g/mol. Its IUPAC name is N,N-dimethyl-4-(2,2,2-trifluoroethoxyamino)piperidine-1-carboxamide.
| Compound Name | N,N-dimethyl-4-(2,2,2-trifluoroethoxyamino)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 83262048 |
| Molecular Formula | C10H18F3N3O2 |
| Molecular Weight | 269.27 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | N,N-dimethyl-4-(2,2,2-trifluoroethoxyamino)piperidine-1-carboxamide |
| SMILES | CN(C)C(=O)N1CCC(NOCC(F)(F)F)CC1 |
| InChI | InChI=1S/C10H18F3N3O2/c1-15(2)9(17)16-5-3-8(4-6-16)14-18-7-10(11,12)13/h8,14H,3-7H2,1-2H3 |
| InChIKey | BPNCKYYQVGBFRL-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.27 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|