About 4-(furan-3-yl)azepane
4-(furan-3-yl)azepane (PubChem CID 83262129) has the molecular formula C10H15NO
and a molecular weight of 165.24 g/mol. Its IUPAC name is 4-(furan-3-yl)azepane.
Molecular Properties
| Compound Name | 4-(furan-3-yl)azepane |
| PubChem CID | 83262129 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | 4-(furan-3-yl)azepane |
| SMILES | c1cc(C2CCCNCC2)co1 |
| InChI | InChI=1S/C10H15NO/c1-2-9(3-6-11-5-1)10-4-7-12-8-10/h4,7-9,11H,1-3,5-6H2 |
| InChIKey | FPKBAZBBBLPHLE-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(furan-3-yl)azepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(furan-3-yl)azepane?
The IUPAC name of 4-(furan-3-yl)azepane (CID 83262129) is 4-(furan-3-yl)azepane.
What is the SMILES notation for 4-(furan-3-yl)azepane?
The canonical SMILES for 4-(furan-3-yl)azepane is c1cc(C2CCCNCC2)co1.
What is the InChIKey of 4-(furan-3-yl)azepane?
The InChIKey is FPKBAZBBBLPHLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO/c1-2-9(3-6-11-5-1)10-4-7-12-8-10/h4,7-9,11H,1-3,5-6H2.
What are the key properties of 4-(furan-3-yl)azepane?
4-(furan-3-yl)azepane has a molecular weight of 165.24 g/mol, XLogP of 2.14, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(furan-3-yl)azepane is sourced from PubChem (CID 83262129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).