About 4-pyridin-3-ylazepane
4-pyridin-3-ylazepane (PubChem CID 83262248) has the molecular formula C11H16N2
and a molecular weight of 176.26 g/mol. Its IUPAC name is 4-pyridin-3-ylazepane.
Molecular Properties
| Compound Name | 4-pyridin-3-ylazepane |
| PubChem CID | 83262248 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 4-pyridin-3-ylazepane |
| SMILES | c1cncc(C2CCCNCC2)c1 |
| InChI | InChI=1S/C11H16N2/c1-3-10(5-8-12-6-1)11-4-2-7-13-9-11/h2,4,7,9-10,12H,1,3,5-6,8H2 |
| InChIKey | LJHLPAKBYCEVMT-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-pyridin-3-ylazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-pyridin-3-ylazepane?
The IUPAC name of 4-pyridin-3-ylazepane (CID 83262248) is 4-pyridin-3-ylazepane.
What is the SMILES notation for 4-pyridin-3-ylazepane?
The canonical SMILES for 4-pyridin-3-ylazepane is c1cncc(C2CCCNCC2)c1.
What is the InChIKey of 4-pyridin-3-ylazepane?
The InChIKey is LJHLPAKBYCEVMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2/c1-3-10(5-8-12-6-1)11-4-2-7-13-9-11/h2,4,7,9-10,12H,1,3,5-6,8H2.
What are the key properties of 4-pyridin-3-ylazepane?
4-pyridin-3-ylazepane has a molecular weight of 176.26 g/mol, XLogP of 1.94, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-pyridin-3-ylazepane is sourced from PubChem (CID 83262248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).