About 4-[(2,4,6-trimethylphenyl)methyl]cyclohex-3-en-1-one
4-[(2,4,6-trimethylphenyl)methyl]cyclohex-3-en-1-one (PubChem CID 83262279) has the molecular formula C16H20O
and a molecular weight of 228.33 g/mol. Its IUPAC name is 4-[(2,4,6-trimethylphenyl)methyl]cyclohex-3-en-1-one.
Molecular Properties
| Compound Name | 4-[(2,4,6-trimethylphenyl)methyl]cyclohex-3-en-1-one |
| PubChem CID | 83262279 |
| Molecular Formula | C16H20O |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | 4-[(2,4,6-trimethylphenyl)methyl]cyclohex-3-en-1-one |
| SMILES | Cc1cc(C)c(CC2=CCC(=O)CC2)c(C)c1 |
| InChI | InChI=1S/C16H20O/c1-11-8-12(2)16(13(3)9-11)10-14-4-6-15(17)7-5-14/h4,8-9H,5-7,10H2,1-3H3 |
| InChIKey | KELRGACYKNMDHP-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2,4,6-trimethylphenyl)methyl]cyclohex-3-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2,4,6-trimethylphenyl)methyl]cyclohex-3-en-1-one?
The IUPAC name of 4-[(2,4,6-trimethylphenyl)methyl]cyclohex-3-en-1-one (CID 83262279) is 4-[(2,4,6-trimethylphenyl)methyl]cyclohex-3-en-1-one.
What is the SMILES notation for 4-[(2,4,6-trimethylphenyl)methyl]cyclohex-3-en-1-one?
The canonical SMILES for 4-[(2,4,6-trimethylphenyl)methyl]cyclohex-3-en-1-one is Cc1cc(C)c(CC2=CCC(=O)CC2)c(C)c1.
What is the InChIKey of 4-[(2,4,6-trimethylphenyl)methyl]cyclohex-3-en-1-one?
The InChIKey is KELRGACYKNMDHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20O/c1-11-8-12(2)16(13(3)9-11)10-14-4-6-15(17)7-5-14/h4,8-9H,5-7,10H2,1-3H3.
What are the key properties of 4-[(2,4,6-trimethylphenyl)methyl]cyclohex-3-en-1-one?
4-[(2,4,6-trimethylphenyl)methyl]cyclohex-3-en-1-one has a molecular weight of 228.33 g/mol, XLogP of 3.83, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,4,6-trimethylphenyl)methyl]cyclohex-3-en-1-one is sourced from PubChem (CID 83262279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).