About 4-(2,3-difluorophenyl)azepane
4-(2,3-difluorophenyl)azepane (PubChem CID 83262443) has the molecular formula C12H15F2N
and a molecular weight of 211.25 g/mol. Its IUPAC name is 4-(2,3-difluorophenyl)azepane.
Molecular Properties
| Compound Name | 4-(2,3-difluorophenyl)azepane |
| PubChem CID | 83262443 |
| Molecular Formula | C12H15F2N |
| Molecular Weight | 211.25 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 4-(2,3-difluorophenyl)azepane |
| SMILES | Fc1cccc(C2CCCNCC2)c1F |
| InChI | InChI=1S/C12H15F2N/c13-11-5-1-4-10(12(11)14)9-3-2-7-15-8-6-9/h1,4-5,9,15H,2-3,6-8H2 |
| InChIKey | VZQQMYWJSOPUIG-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.25 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(2,3-difluorophenyl)azepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,3-difluorophenyl)azepane?
The IUPAC name of 4-(2,3-difluorophenyl)azepane (CID 83262443) is 4-(2,3-difluorophenyl)azepane.
What is the SMILES notation for 4-(2,3-difluorophenyl)azepane?
The canonical SMILES for 4-(2,3-difluorophenyl)azepane is Fc1cccc(C2CCCNCC2)c1F.
What is the InChIKey of 4-(2,3-difluorophenyl)azepane?
The InChIKey is VZQQMYWJSOPUIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15F2N/c13-11-5-1-4-10(12(11)14)9-3-2-7-15-8-6-9/h1,4-5,9,15H,2-3,6-8H2.
What are the key properties of 4-(2,3-difluorophenyl)azepane?
4-(2,3-difluorophenyl)azepane has a molecular weight of 211.25 g/mol, XLogP of 2.82, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,3-difluorophenyl)azepane is sourced from PubChem (CID 83262443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).