C17H26N2OS — CID 83262823
3-[2-(4-methylcyclohexyl)ethyl]-2-(5-methylthiophen-2-yl)imidazolidin-4-one (PubChem CID 83262823) has the molecular formula C17H26N2OS and a molecular weight of 306.47 g/mol. Its IUPAC name is 3-[2-(4-methylcyclohexyl)ethyl]-2-(5-methylthiophen-2-yl)imidazolidin-4-one.
| Compound Name | 3-[2-(4-methylcyclohexyl)ethyl]-2-(5-methylthiophen-2-yl)imidazolidin-4-one |
|---|---|
| PubChem CID | 83262823 |
| Molecular Formula | C17H26N2OS |
| Molecular Weight | 306.47 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 3-[2-(4-methylcyclohexyl)ethyl]-2-(5-methylthiophen-2-yl)imidazolidin-4-one |
| SMILES | Cc1ccc(C2NCC(=O)N2CCC2CCC(C)CC2)s1 |
| InChI | InChI=1S/C17H26N2OS/c1-12-3-6-14(7-4-12)9-10-19-16(20)11-18-17(19)15-8-5-13(2)21-15/h5,8,12,14,17-18H,3-4,6-7,9-11H2,1-2H3 |
| InChIKey | MNOOKNYJIKQUSF-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.47 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |