About 3-(1,1-dioxothian-3-yl)-2-(3-methylphenyl)imidazolidin-4-one
3-(1,1-dioxothian-3-yl)-2-(3-methylphenyl)imidazolidin-4-one (PubChem CID 83263212) has the molecular formula C15H20N2O3S
and a molecular weight of 308.40 g/mol. Its IUPAC name is 3-(1,1-dioxothian-3-yl)-2-(3-methylphenyl)imidazolidin-4-one.
Molecular Properties
| Compound Name | 3-(1,1-dioxothian-3-yl)-2-(3-methylphenyl)imidazolidin-4-one |
| PubChem CID | 83263212 |
| Molecular Formula | C15H20N2O3S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 3-(1,1-dioxothian-3-yl)-2-(3-methylphenyl)imidazolidin-4-one |
| SMILES | Cc1cccc(C2NCC(=O)N2C2CCCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C15H20N2O3S/c1-11-4-2-5-12(8-11)15-16-9-14(18)17(15)13-6-3-7-21(19,20)10-13/h2,4-5,8,13,15-16H,3,6-7,9-10H2,1H3 |
| InChIKey | UZAQKGCQEKLTKN-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(1,1-dioxothian-3-yl)-2-(3-methylphenyl)imidazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,1-dioxothian-3-yl)-2-(3-methylphenyl)imidazolidin-4-one?
The IUPAC name of 3-(1,1-dioxothian-3-yl)-2-(3-methylphenyl)imidazolidin-4-one (CID 83263212) is 3-(1,1-dioxothian-3-yl)-2-(3-methylphenyl)imidazolidin-4-one.
What is the SMILES notation for 3-(1,1-dioxothian-3-yl)-2-(3-methylphenyl)imidazolidin-4-one?
The canonical SMILES for 3-(1,1-dioxothian-3-yl)-2-(3-methylphenyl)imidazolidin-4-one is Cc1cccc(C2NCC(=O)N2C2CCCS(=O)(=O)C2)c1.
What is the InChIKey of 3-(1,1-dioxothian-3-yl)-2-(3-methylphenyl)imidazolidin-4-one?
The InChIKey is UZAQKGCQEKLTKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2O3S/c1-11-4-2-5-12(8-11)15-16-9-14(18)17(15)13-6-3-7-21(19,20)10-13/h2,4-5,8,13,15-16H,3,6-7,9-10H2,1H3.
What are the key properties of 3-(1,1-dioxothian-3-yl)-2-(3-methylphenyl)imidazolidin-4-one?
3-(1,1-dioxothian-3-yl)-2-(3-methylphenyl)imidazolidin-4-one has a molecular weight of 308.40 g/mol, XLogP of 1.00, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,1-dioxothian-3-yl)-2-(3-methylphenyl)imidazolidin-4-one is sourced from PubChem (CID 83263212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).