C16H23FN2OS — CID 83263347
5-butan-2-yl-2-(3-fluorophenyl)-3-(2-methylsulfanylethyl)imidazolidin-4-one (PubChem CID 83263347) has the molecular formula C16H23FN2OS and a molecular weight of 310.44 g/mol. Its IUPAC name is 5-butan-2-yl-2-(3-fluorophenyl)-3-(2-methylsulfanylethyl)imidazolidin-4-one.
| Compound Name | 5-butan-2-yl-2-(3-fluorophenyl)-3-(2-methylsulfanylethyl)imidazolidin-4-one |
|---|---|
| PubChem CID | 83263347 |
| Molecular Formula | C16H23FN2OS |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 5-butan-2-yl-2-(3-fluorophenyl)-3-(2-methylsulfanylethyl)imidazolidin-4-one |
| SMILES | CCC(C)C1NC(c2cccc(F)c2)N(CCSC)C1=O |
| InChI | InChI=1S/C16H23FN2OS/c1-4-11(2)14-16(20)19(8-9-21-3)15(18-14)12-6-5-7-13(17)10-12/h5-7,10-11,14-15,18H,4,8-9H2,1-3H3 |
| InChIKey | ZYYDWCKKFKSAGA-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |