C13H15F3N2O2S — CID 83264204
5-thiophen-2-yl-6-[2-(2,2,2-trifluoroethoxy)ethyl]-4,6-diazaspiro[2.4]heptan-7-one (PubChem CID 83264204) has the molecular formula C13H15F3N2O2S and a molecular weight of 320.34 g/mol. Its IUPAC name is 5-thiophen-2-yl-6-[2-(2,2,2-trifluoroethoxy)ethyl]-4,6-diazaspiro[2.4]heptan-7-one.
| Compound Name | 5-thiophen-2-yl-6-[2-(2,2,2-trifluoroethoxy)ethyl]-4,6-diazaspiro[2.4]heptan-7-one |
|---|---|
| PubChem CID | 83264204 |
| Molecular Formula | C13H15F3N2O2S |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 5-thiophen-2-yl-6-[2-(2,2,2-trifluoroethoxy)ethyl]-4,6-diazaspiro[2.4]heptan-7-one |
| SMILES | O=C1N(CCOCC(F)(F)F)C(c2cccs2)NC12CC2 |
| InChI | InChI=1S/C13H15F3N2O2S/c14-13(15,16)8-20-6-5-18-10(9-2-1-7-21-9)17-12(3-4-12)11(18)19/h1-2,7,10,17H,3-6,8H2 |
| InChIKey | IQHIEEUFFJCIIZ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|