C13H17F3N2O2S — CID 83264528
5-ethyl-2-thiophen-3-yl-3-[2-(2,2,2-trifluoroethoxy)ethyl]imidazolidin-4-one (PubChem CID 83264528) has the molecular formula C13H17F3N2O2S and a molecular weight of 322.35 g/mol. Its IUPAC name is 5-ethyl-2-thiophen-3-yl-3-[2-(2,2,2-trifluoroethoxy)ethyl]imidazolidin-4-one.
| Compound Name | 5-ethyl-2-thiophen-3-yl-3-[2-(2,2,2-trifluoroethoxy)ethyl]imidazolidin-4-one |
|---|---|
| PubChem CID | 83264528 |
| Molecular Formula | C13H17F3N2O2S |
| Molecular Weight | 322.35 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 5-ethyl-2-thiophen-3-yl-3-[2-(2,2,2-trifluoroethoxy)ethyl]imidazolidin-4-one |
| SMILES | CCC1NC(c2ccsc2)N(CCOCC(F)(F)F)C1=O |
| InChI | InChI=1S/C13H17F3N2O2S/c1-2-10-12(19)18(4-5-20-8-13(14,15)16)11(17-10)9-3-6-21-7-9/h3,6-7,10-11,17H,2,4-5,8H2,1H3 |
| InChIKey | BPIYWZFHWBKVJF-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.35 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|