C14H17N3 — CID 83265107
5-methyl-2-N-(1-phenylethyl)pyridine-2,4-diamine (PubChem CID 83265107) has the molecular formula C14H17N3 and a molecular weight of 227.31 g/mol. Its IUPAC name is 5-methyl-2-N-(1-phenylethyl)pyridine-2,4-diamine.
| Compound Name | 5-methyl-2-N-(1-phenylethyl)pyridine-2,4-diamine |
|---|---|
| PubChem CID | 83265107 |
| Molecular Formula | C14H17N3 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | 5-methyl-2-N-(1-phenylethyl)pyridine-2,4-diamine |
| SMILES | Cc1cnc(NC(C)c2ccccc2)cc1N |
| InChI | InChI=1S/C14H17N3/c1-10-9-16-14(8-13(10)15)17-11(2)12-6-4-3-5-7-12/h3-9,11H,1-2H3,(H3,15,16,17) |
| InChIKey | MQEXGKKJHYUQJV-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |