C13H15N3O — CID 83265211
2-N-(2-methoxyphenyl)-5-methylpyridine-2,4-diamine (PubChem CID 83265211) has the molecular formula C13H15N3O and a molecular weight of 229.28 g/mol. Its IUPAC name is 2-N-(2-methoxyphenyl)-5-methylpyridine-2,4-diamine.
| Compound Name | 2-N-(2-methoxyphenyl)-5-methylpyridine-2,4-diamine |
|---|---|
| PubChem CID | 83265211 |
| Molecular Formula | C13H15N3O |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | 2-N-(2-methoxyphenyl)-5-methylpyridine-2,4-diamine |
| SMILES | COc1ccccc1Nc1cc(N)c(C)cn1 |
| InChI | InChI=1S/C13H15N3O/c1-9-8-15-13(7-10(9)14)16-11-5-3-4-6-12(11)17-2/h3-8H,1-2H3,(H3,14,15,16) |
| InChIKey | RQJRHMPSLWLVIA-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |