C14H20N4O — CID 83265761
6-(4-amino-5-methyl-2-pyridinyl)-1,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-2-one (PubChem CID 83265761) has the molecular formula C14H20N4O and a molecular weight of 260.34 g/mol. Its IUPAC name is 6-(4-amino-5-methyl-2-pyridinyl)-1,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-2-one.
| Compound Name | 6-(4-amino-5-methyl-2-pyridinyl)-1,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 83265761 |
| Molecular Formula | C14H20N4O |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 6-(4-amino-5-methyl-2-pyridinyl)-1,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-2-one |
| SMILES | Cc1cnc(N2CCC3NC(=O)CCC3C2)cc1N |
| InChI | InChI=1S/C14H20N4O/c1-9-7-16-13(6-11(9)15)18-5-4-12-10(8-18)2-3-14(19)17-12/h6-7,10,12H,2-5,8H2,1H3,(H2,15,16)(H,17,19) |
| InChIKey | LCCLSIIYWPQEBV-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |