About 4-(ethylamino)-N,N-dimethyl-4-(4-methyl-1,3-thiazol-2-yl)piperidine-1-carboxamide
4-(ethylamino)-N,N-dimethyl-4-(4-methyl-1,3-thiazol-2-yl)piperidine-1-carboxamide (PubChem CID 83266070) has the molecular formula C14H24N4OS
and a molecular weight of 296.44 g/mol. Its IUPAC name is 4-(ethylamino)-N,N-dimethyl-4-(4-methyl-1,3-thiazol-2-yl)piperidine-1-carboxamide.
Molecular Properties
| Compound Name | 4-(ethylamino)-N,N-dimethyl-4-(4-methyl-1,3-thiazol-2-yl)piperidine-1-carboxamide |
| PubChem CID | 83266070 |
| Molecular Formula | C14H24N4OS |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 4-(ethylamino)-N,N-dimethyl-4-(4-methyl-1,3-thiazol-2-yl)piperidine-1-carboxamide |
| SMILES | CCNC1(c2nc(C)cs2)CCN(C(=O)N(C)C)CC1 |
| InChI | InChI=1S/C14H24N4OS/c1-5-15-14(12-16-11(2)10-20-12)6-8-18(9-7-14)13(19)17(3)4/h10,15H,5-9H2,1-4H3 |
| InChIKey | LVBOJOCCBPICJA-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(ethylamino)-N,N-dimethyl-4-(4-methyl-1,3-thiazol-2-yl)piperidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(ethylamino)-N,N-dimethyl-4-(4-methyl-1,3-thiazol-2-yl)piperidine-1-carboxamide?
The IUPAC name of 4-(ethylamino)-N,N-dimethyl-4-(4-methyl-1,3-thiazol-2-yl)piperidine-1-carboxamide (CID 83266070) is 4-(ethylamino)-N,N-dimethyl-4-(4-methyl-1,3-thiazol-2-yl)piperidine-1-carboxamide.
What is the SMILES notation for 4-(ethylamino)-N,N-dimethyl-4-(4-methyl-1,3-thiazol-2-yl)piperidine-1-carboxamide?
The canonical SMILES for 4-(ethylamino)-N,N-dimethyl-4-(4-methyl-1,3-thiazol-2-yl)piperidine-1-carboxamide is CCNC1(c2nc(C)cs2)CCN(C(=O)N(C)C)CC1.
What is the InChIKey of 4-(ethylamino)-N,N-dimethyl-4-(4-methyl-1,3-thiazol-2-yl)piperidine-1-carboxamide?
The InChIKey is LVBOJOCCBPICJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N4OS/c1-5-15-14(12-16-11(2)10-20-12)6-8-18(9-7-14)13(19)17(3)4/h10,15H,5-9H2,1-4H3.
What are the key properties of 4-(ethylamino)-N,N-dimethyl-4-(4-methyl-1,3-thiazol-2-yl)piperidine-1-carboxamide?
4-(ethylamino)-N,N-dimethyl-4-(4-methyl-1,3-thiazol-2-yl)piperidine-1-carboxamide has a molecular weight of 296.44 g/mol, XLogP of 2.03, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(ethylamino)-N,N-dimethyl-4-(4-methyl-1,3-thiazol-2-yl)piperidine-1-carboxamide is sourced from PubChem (CID 83266070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).