C10H14F3N3O — CID 83266133
5-methyl-2-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyridine-2,4-diamine (PubChem CID 83266133) has the molecular formula C10H14F3N3O and a molecular weight of 249.24 g/mol. Its IUPAC name is 5-methyl-2-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyridine-2,4-diamine.
| Compound Name | 5-methyl-2-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyridine-2,4-diamine |
|---|---|
| PubChem CID | 83266133 |
| Molecular Formula | C10H14F3N3O |
| Molecular Weight | 249.24 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | 5-methyl-2-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyridine-2,4-diamine |
| SMILES | Cc1cnc(NCCOCC(F)(F)F)cc1N |
| InChI | InChI=1S/C10H14F3N3O/c1-7-5-16-9(4-8(7)14)15-2-3-17-6-10(11,12)13/h4-5H,2-3,6H2,1H3,(H3,14,15,16) |
| InChIKey | XRZTXJMVXHRCHG-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.24 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|