C15H18N2O2 — CID 83267065
2-[4-(2-methoxyethyl)phenoxy]-5-methylpyridin-4-amine (PubChem CID 83267065) has the molecular formula C15H18N2O2 and a molecular weight of 258.32 g/mol. Its IUPAC name is 2-[4-(2-methoxyethyl)phenoxy]-5-methylpyridin-4-amine.
| Compound Name | 2-[4-(2-methoxyethyl)phenoxy]-5-methylpyridin-4-amine |
|---|---|
| PubChem CID | 83267065 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 2-[4-(2-methoxyethyl)phenoxy]-5-methylpyridin-4-amine |
| SMILES | COCCc1ccc(Oc2cc(N)c(C)cn2)cc1 |
| InChI | InChI=1S/C15H18N2O2/c1-11-10-17-15(9-14(11)16)19-13-5-3-12(4-6-13)7-8-18-2/h3-6,9-10H,7-8H2,1-2H3,(H2,16,17) |
| InChIKey | YVNOKOBTWKZGME-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |