C16H21FN2O2 — CID 83267208
2-(2-fluorophenyl)-3-(oxolan-3-yl)-5-propylimidazolidin-4-one (PubChem CID 83267208) has the molecular formula C16H21FN2O2 and a molecular weight of 292.35 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-3-(oxolan-3-yl)-5-propylimidazolidin-4-one.
| Compound Name | 2-(2-fluorophenyl)-3-(oxolan-3-yl)-5-propylimidazolidin-4-one |
|---|---|
| PubChem CID | 83267208 |
| Molecular Formula | C16H21FN2O2 |
| Molecular Weight | 292.35 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 2-(2-fluorophenyl)-3-(oxolan-3-yl)-5-propylimidazolidin-4-one |
| SMILES | CCCC1NC(c2ccccc2F)N(C2CCOC2)C1=O |
| InChI | InChI=1S/C16H21FN2O2/c1-2-5-14-16(20)19(11-8-9-21-10-11)15(18-14)12-6-3-4-7-13(12)17/h3-4,6-7,11,14-15,18H,2,5,8-10H2,1H3 |
| InChIKey | BLXOLLGMGAOXBC-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.35 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |