C16H29N3O2 — CID 83268859
3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-5-ethyl-2-propan-2-ylimidazolidin-4-one (PubChem CID 83268859) has the molecular formula C16H29N3O2 and a molecular weight of 295.43 g/mol. Its IUPAC name is 3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-5-ethyl-2-propan-2-ylimidazolidin-4-one.
| Compound Name | 3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-5-ethyl-2-propan-2-ylimidazolidin-4-one |
|---|---|
| PubChem CID | 83268859 |
| Molecular Formula | C16H29N3O2 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.23 |
| IUPAC Name | 3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-5-ethyl-2-propan-2-ylimidazolidin-4-one |
| SMILES | CCC1NC(C(C)C)N(CC2CN3CCCC3CO2)C1=O |
| InChI | InChI=1S/C16H29N3O2/c1-4-14-16(20)19(15(17-14)11(2)3)9-13-8-18-7-5-6-12(18)10-21-13/h11-15,17H,4-10H2,1-3H3 |
| InChIKey | CSZJKPKWWBWBNM-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |