About 2-chloro-4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)-5-methylpyridine
2-chloro-4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)-5-methylpyridine (PubChem CID 83269545) has the molecular formula C14H12ClNO2S
and a molecular weight of 293.78 g/mol. Its IUPAC name is 2-chloro-4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)-5-methylpyridine.
Molecular Properties
| Compound Name | 2-chloro-4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)-5-methylpyridine |
| PubChem CID | 83269545 |
| Molecular Formula | C14H12ClNO2S |
| Molecular Weight | 293.78 g/mol |
| Exact Mass | 293.03 |
| IUPAC Name | 2-chloro-4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)-5-methylpyridine |
| SMILES | Cc1cnc(Cl)cc1Sc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C14H12ClNO2S/c1-9-8-16-14(15)7-13(9)19-10-2-3-11-12(6-10)18-5-4-17-11/h2-3,6-8H,4-5H2,1H3 |
| InChIKey | AOFKCYVFYVBLQZ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.78 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)-5-methylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)-5-methylpyridine?
The IUPAC name of 2-chloro-4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)-5-methylpyridine (CID 83269545) is 2-chloro-4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)-5-methylpyridine.
What is the SMILES notation for 2-chloro-4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)-5-methylpyridine?
The canonical SMILES for 2-chloro-4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)-5-methylpyridine is Cc1cnc(Cl)cc1Sc1ccc2c(c1)OCCO2.
What is the InChIKey of 2-chloro-4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)-5-methylpyridine?
The InChIKey is AOFKCYVFYVBLQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12ClNO2S/c1-9-8-16-14(15)7-13(9)19-10-2-3-11-12(6-10)18-5-4-17-11/h2-3,6-8H,4-5H2,1H3.
What are the key properties of 2-chloro-4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)-5-methylpyridine?
2-chloro-4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)-5-methylpyridine has a molecular weight of 293.78 g/mol, XLogP of 3.97, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)-5-methylpyridine is sourced from PubChem (CID 83269545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).