C18H34N2O — CID 83269555
5-butyl-3-(2,2-dimethylcyclohexyl)-2-propylimidazolidin-4-one (PubChem CID 83269555) has the molecular formula C18H34N2O and a molecular weight of 294.48 g/mol. Its IUPAC name is 5-butyl-3-(2,2-dimethylcyclohexyl)-2-propylimidazolidin-4-one.
| Compound Name | 5-butyl-3-(2,2-dimethylcyclohexyl)-2-propylimidazolidin-4-one |
|---|---|
| PubChem CID | 83269555 |
| Molecular Formula | C18H34N2O |
| Molecular Weight | 294.48 g/mol |
| Exact Mass | 294.27 |
| IUPAC Name | 5-butyl-3-(2,2-dimethylcyclohexyl)-2-propylimidazolidin-4-one |
| SMILES | CCCCC1NC(CCC)N(C2CCCCC2(C)C)C1=O |
| InChI | InChI=1S/C18H34N2O/c1-5-7-11-14-17(21)20(16(19-14)10-6-2)15-12-8-9-13-18(15,3)4/h14-16,19H,5-13H2,1-4H3 |
| InChIKey | SHLUZNDONNMYKT-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.48 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |