C16H21ClN2OS — CID 83269990
2-(4-chlorophenyl)-5-ethyl-3-(thiolan-2-ylmethyl)imidazolidin-4-one (PubChem CID 83269990) has the molecular formula C16H21ClN2OS and a molecular weight of 324.88 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-5-ethyl-3-(thiolan-2-ylmethyl)imidazolidin-4-one.
| Compound Name | 2-(4-chlorophenyl)-5-ethyl-3-(thiolan-2-ylmethyl)imidazolidin-4-one |
|---|---|
| PubChem CID | 83269990 |
| Molecular Formula | C16H21ClN2OS |
| Molecular Weight | 324.88 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 2-(4-chlorophenyl)-5-ethyl-3-(thiolan-2-ylmethyl)imidazolidin-4-one |
| SMILES | CCC1NC(c2ccc(Cl)cc2)N(CC2CCCS2)C1=O |
| InChI | InChI=1S/C16H21ClN2OS/c1-2-14-16(20)19(10-13-4-3-9-21-13)15(18-14)11-5-7-12(17)8-6-11/h5-8,13-15,18H,2-4,9-10H2,1H3 |
| InChIKey | MJWOEXGDVUFDFA-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.88 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |