C16H26N2OS — CID 83271256
5-(2-methylpropyl)-3-[(4-methylthiophen-3-yl)methyl]-2-propylimidazolidin-4-one (PubChem CID 83271256) has the molecular formula C16H26N2OS and a molecular weight of 294.46 g/mol. Its IUPAC name is 5-(2-methylpropyl)-3-[(4-methylthiophen-3-yl)methyl]-2-propylimidazolidin-4-one.
| Compound Name | 5-(2-methylpropyl)-3-[(4-methylthiophen-3-yl)methyl]-2-propylimidazolidin-4-one |
|---|---|
| PubChem CID | 83271256 |
| Molecular Formula | C16H26N2OS |
| Molecular Weight | 294.46 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | 5-(2-methylpropyl)-3-[(4-methylthiophen-3-yl)methyl]-2-propylimidazolidin-4-one |
| SMILES | CCCC1NC(CC(C)C)C(=O)N1Cc1cscc1C |
| InChI | InChI=1S/C16H26N2OS/c1-5-6-15-17-14(7-11(2)3)16(19)18(15)8-13-10-20-9-12(13)4/h9-11,14-15,17H,5-8H2,1-4H3 |
| InChIKey | ZDAARVSMHGSMFO-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.46 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |