About [4-(5-ethylsulfonyl-1,3-benzoxazol-2-yl)-2-nitrophenyl] 2-(trifluoromethoxy)benzenesulfonate
[4-(5-ethylsulfonyl-1,3-benzoxazol-2-yl)-2-nitrophenyl] 2-(trifluoromethoxy)benzenesulfonate (PubChem CID 83273698) has the molecular formula C22H15F3N2O9S2
and a molecular weight of 572.50 g/mol. Its IUPAC name is [4-(5-ethylsulfonyl-1,3-benzoxazol-2-yl)-2-nitrophenyl] 2-(trifluoromethoxy)benzenesulfonate.
Molecular Properties
| Compound Name | [4-(5-ethylsulfonyl-1,3-benzoxazol-2-yl)-2-nitrophenyl] 2-(trifluoromethoxy)benzenesulfonate |
| PubChem CID | 83273698 |
| Molecular Formula | C22H15F3N2O9S2 |
| Molecular Weight | 572.50 g/mol |
| Exact Mass | 572.02 |
| IUPAC Name | [4-(5-ethylsulfonyl-1,3-benzoxazol-2-yl)-2-nitrophenyl] 2-(trifluoromethoxy)benzenesulfonate |
| SMILES | CCS(=O)(=O)c1ccc2oc(-c3ccc(OS(=O)(=O)c4ccccc4OC(F)(F)F)c([N+](=O)[O-])c3)nc2c1 |
| InChI | InChI=1S/C22H15F3N2O9S2/c1-2-37(30,31)14-8-10-17-15(12-14)26-21(34-17)13-7-9-18(16(11-13)27(28)29)36-38(32,33)20-6-4-3-5-19(20)35-22(23,24)25/h3-12H,2H2,1H3 |
| InChIKey | APGLQDWGFJXPMO-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 155.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 572.50 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [4-(5-ethylsulfonyl-1,3-benzoxazol-2-yl)-2-nitrophenyl] 2-(trifluoromethoxy)benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(5-ethylsulfonyl-1,3-benzoxazol-2-yl)-2-nitrophenyl] 2-(trifluoromethoxy)benzenesulfonate?
The IUPAC name of [4-(5-ethylsulfonyl-1,3-benzoxazol-2-yl)-2-nitrophenyl] 2-(trifluoromethoxy)benzenesulfonate (CID 83273698) is [4-(5-ethylsulfonyl-1,3-benzoxazol-2-yl)-2-nitrophenyl] 2-(trifluoromethoxy)benzenesulfonate.
What is the SMILES notation for [4-(5-ethylsulfonyl-1,3-benzoxazol-2-yl)-2-nitrophenyl] 2-(trifluoromethoxy)benzenesulfonate?
The canonical SMILES for [4-(5-ethylsulfonyl-1,3-benzoxazol-2-yl)-2-nitrophenyl] 2-(trifluoromethoxy)benzenesulfonate is CCS(=O)(=O)c1ccc2oc(-c3ccc(OS(=O)(=O)c4ccccc4OC(F)(F)F)c([N+](=O)[O-])c3)nc2c1.
What is the InChIKey of [4-(5-ethylsulfonyl-1,3-benzoxazol-2-yl)-2-nitrophenyl] 2-(trifluoromethoxy)benzenesulfonate?
The InChIKey is APGLQDWGFJXPMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H15F3N2O9S2/c1-2-37(30,31)14-8-10-17-15(12-14)26-21(34-17)13-7-9-18(16(11-13)27(28)29)36-38(32,33)20-6-4-3-5-19(20)35-22(23,24)25/h3-12H,2H2,1H3.
What are the key properties of [4-(5-ethylsulfonyl-1,3-benzoxazol-2-yl)-2-nitrophenyl] 2-(trifluoromethoxy)benzenesulfonate?
[4-(5-ethylsulfonyl-1,3-benzoxazol-2-yl)-2-nitrophenyl] 2-(trifluoromethoxy)benzenesulfonate has a molecular weight of 572.50 g/mol, XLogP of 4.86, 8 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(5-ethylsulfonyl-1,3-benzoxazol-2-yl)-2-nitrophenyl] 2-(trifluoromethoxy)benzenesulfonate is sourced from PubChem (CID 83273698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).