C19H27FN4OS — CID 83273986
2-butan-2-yl-N-(2-fluorophenyl)-4-methyl-3-oxo-1,4,8-triazaspiro[4.5]decane-8-carbothioamide (PubChem CID 83273986) has the molecular formula C19H27FN4OS and a molecular weight of 378.52 g/mol. Its IUPAC name is 2-butan-2-yl-N-(2-fluorophenyl)-4-methyl-3-oxo-1,4,8-triazaspiro[4.5]decane-8-carbothioamide.
| Compound Name | 2-butan-2-yl-N-(2-fluorophenyl)-4-methyl-3-oxo-1,4,8-triazaspiro[4.5]decane-8-carbothioamide |
|---|---|
| PubChem CID | 83273986 |
| Molecular Formula | C19H27FN4OS |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | 2-butan-2-yl-N-(2-fluorophenyl)-4-methyl-3-oxo-1,4,8-triazaspiro[4.5]decane-8-carbothioamide |
| SMILES | CCC(C)C1NC2(CCN(C(=S)Nc3ccccc3F)CC2)N(C)C1=O |
| InChI | InChI=1S/C19H27FN4OS/c1-4-13(2)16-17(25)23(3)19(22-16)9-11-24(12-10-19)18(26)21-15-8-6-5-7-14(15)20/h5-8,13,16,22H,4,9-12H2,1-3H3,(H,21,26) |
| InChIKey | QEDSURJYXJAIJR-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|