C20H21BrN2O5 — CID 83275590
(1R,9S)-4-bromo-10-(3,4-dimethoxyphenyl)-6-methoxy-9-methyl-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-11-one (PubChem CID 83275590) has the molecular formula C20H21BrN2O5 and a molecular weight of 449.30 g/mol. Its IUPAC name is (1R,9S)-4-bromo-10-(3,4-dimethoxyphenyl)-6-methoxy-9-methyl-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-11-one.
| Compound Name | (1R,9S)-4-bromo-10-(3,4-dimethoxyphenyl)-6-methoxy-9-methyl-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-11-one |
|---|---|
| PubChem CID | 83275590 |
| Molecular Formula | C20H21BrN2O5 |
| Molecular Weight | 449.30 g/mol |
| Exact Mass | 448.06 |
| IUPAC Name | (1R,9S)-4-bromo-10-(3,4-dimethoxyphenyl)-6-methoxy-9-methyl-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-11-one |
| SMILES | COc1ccc(N2C(=O)N[C@@H]3C[C@]2(C)Oc2c(OC)cc(Br)cc23)cc1OC |
| InChI | InChI=1S/C20H21BrN2O5/c1-20-10-14(13-7-11(21)8-17(27-4)18(13)28-20)22-19(24)23(20)12-5-6-15(25-2)16(9-12)26-3/h5-9,14H,10H2,1-4H3,(H,22,24)/t14-,20+/m1/s1 |
| InChIKey | IYQAYKKXWQWDHJ-VLIAUNLRSA-N |
| XLogP | 4.24 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.30 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |