C27H25F3N4O4 — CID 83277231
N-[3-[3-(2-methoxyethoxy)-5-(4-methoxyphenyl)-1,2,4-triazol-1-yl]phenyl]-4-methyl-3-(trifluoromethyl)benzamide (PubChem CID 83277231) has the molecular formula C27H25F3N4O4 and a molecular weight of 526.52 g/mol. Its IUPAC name is N-[3-[3-(2-methoxyethoxy)-5-(4-methoxyphenyl)-1,2,4-triazol-1-yl]phenyl]-4-methyl-3-(trifluoromethyl)benzamide.
| Compound Name | N-[3-[3-(2-methoxyethoxy)-5-(4-methoxyphenyl)-1,2,4-triazol-1-yl]phenyl]-4-methyl-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 83277231 |
| Molecular Formula | C27H25F3N4O4 |
| Molecular Weight | 526.52 g/mol |
| Exact Mass | 526.18 |
| IUPAC Name | N-[3-[3-(2-methoxyethoxy)-5-(4-methoxyphenyl)-1,2,4-triazol-1-yl]phenyl]-4-methyl-3-(trifluoromethyl)benzamide |
| SMILES | COCCOc1nc(-c2ccc(OC)cc2)n(-c2cccc(NC(=O)c3ccc(C)c(C(F)(F)F)c3)c2)n1 |
| InChI | InChI=1S/C27H25F3N4O4/c1-17-7-8-19(15-23(17)27(28,29)30)25(35)31-20-5-4-6-21(16-20)34-24(18-9-11-22(37-3)12-10-18)32-26(33-34)38-14-13-36-2/h4-12,15-16H,13-14H2,1-3H3,(H,31,35) |
| InChIKey | OCDKHBKOLSGMAN-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.52 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|