C22H30N4O4 — CID 83279542
N-cyclohexyl-3,3-dimethyl-N-[2-[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]ethyl]butanamide (PubChem CID 83279542) has the molecular formula C22H30N4O4 and a molecular weight of 414.51 g/mol. Its IUPAC name is N-cyclohexyl-3,3-dimethyl-N-[2-[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]ethyl]butanamide.
| Compound Name | N-cyclohexyl-3,3-dimethyl-N-[2-[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]ethyl]butanamide |
|---|---|
| PubChem CID | 83279542 |
| Molecular Formula | C22H30N4O4 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | N-cyclohexyl-3,3-dimethyl-N-[2-[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]ethyl]butanamide |
| SMILES | CC(C)(C)CC(=O)N(CCc1nc(-c2cccc([N+](=O)[O-])c2)no1)C1CCCCC1 |
| InChI | InChI=1S/C22H30N4O4/c1-22(2,3)15-20(27)25(17-9-5-4-6-10-17)13-12-19-23-21(24-30-19)16-8-7-11-18(14-16)26(28)29/h7-8,11,14,17H,4-6,9-10,12-13,15H2,1-3H3 |
| InChIKey | CKIPCNQEGSRWBA-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 102.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|