C20H19ClN4O2S — CID 83281297
[4-[6-(4-chlorophenoxy)pyrimidin-4-yl]-2-methylpiperazin-1-yl]-thiophen-2-ylmethanone (PubChem CID 83281297) has the molecular formula C20H19ClN4O2S and a molecular weight of 414.92 g/mol. Its IUPAC name is [4-[6-(4-chlorophenoxy)pyrimidin-4-yl]-2-methylpiperazin-1-yl]-thiophen-2-ylmethanone.
| Compound Name | [4-[6-(4-chlorophenoxy)pyrimidin-4-yl]-2-methylpiperazin-1-yl]-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 83281297 |
| Molecular Formula | C20H19ClN4O2S |
| Molecular Weight | 414.92 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | [4-[6-(4-chlorophenoxy)pyrimidin-4-yl]-2-methylpiperazin-1-yl]-thiophen-2-ylmethanone |
| SMILES | CC1CN(c2cc(Oc3ccc(Cl)cc3)ncn2)CCN1C(=O)c1cccs1 |
| InChI | InChI=1S/C20H19ClN4O2S/c1-14-12-24(8-9-25(14)20(26)17-3-2-10-28-17)18-11-19(23-13-22-18)27-16-6-4-15(21)5-7-16/h2-7,10-11,13-14H,8-9,12H2,1H3 |
| InChIKey | DMMMFMKCAKGFMP-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.92 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |