C23H26N4O6 — CID 83281470
N-butan-2-yl-N-[2-[3-(3,5-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]ethyl]-3-nitrobenzamide (PubChem CID 83281470) has the molecular formula C23H26N4O6 and a molecular weight of 454.48 g/mol. Its IUPAC name is N-butan-2-yl-N-[2-[3-(3,5-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]ethyl]-3-nitrobenzamide.
| Compound Name | N-butan-2-yl-N-[2-[3-(3,5-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]ethyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 83281470 |
| Molecular Formula | C23H26N4O6 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | N-butan-2-yl-N-[2-[3-(3,5-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]ethyl]-3-nitrobenzamide |
| SMILES | CCC(C)N(CCc1nc(-c2cc(OC)cc(OC)c2)no1)C(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H26N4O6/c1-5-15(2)26(23(28)16-7-6-8-18(11-16)27(29)30)10-9-21-24-22(25-33-21)17-12-19(31-3)14-20(13-17)32-4/h6-8,11-15H,5,9-10H2,1-4H3 |
| InChIKey | JLFJXGRJMLEBNE-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 120.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|