About ethyl 2-[5-chloro-2-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenoxy]sulfonylbenzoate
ethyl 2-[5-chloro-2-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenoxy]sulfonylbenzoate (PubChem CID 83282449) has the molecular formula C21H15ClN2O6S
and a molecular weight of 458.88 g/mol. Its IUPAC name is ethyl 2-[5-chloro-2-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenoxy]sulfonylbenzoate.
Molecular Properties
| Compound Name | ethyl 2-[5-chloro-2-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenoxy]sulfonylbenzoate |
| PubChem CID | 83282449 |
| Molecular Formula | C21H15ClN2O6S |
| Molecular Weight | 458.88 g/mol |
| Exact Mass | 458.03 |
| IUPAC Name | ethyl 2-[5-chloro-2-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenoxy]sulfonylbenzoate |
| SMILES | CCOC(=O)c1ccccc1S(=O)(=O)Oc1cc(Cl)ccc1-c1nc2ncccc2o1 |
| InChI | InChI=1S/C21H15ClN2O6S/c1-2-28-21(25)15-6-3-4-8-18(15)31(26,27)30-17-12-13(22)9-10-14(17)20-24-19-16(29-20)7-5-11-23-19/h3-12H,2H2,1H3 |
| InChIKey | QNNFCCAJWANTBV-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 108.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 458.88 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[5-chloro-2-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenoxy]sulfonylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[5-chloro-2-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenoxy]sulfonylbenzoate?
The IUPAC name of ethyl 2-[5-chloro-2-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenoxy]sulfonylbenzoate (CID 83282449) is ethyl 2-[5-chloro-2-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenoxy]sulfonylbenzoate.
What is the SMILES notation for ethyl 2-[5-chloro-2-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenoxy]sulfonylbenzoate?
The canonical SMILES for ethyl 2-[5-chloro-2-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenoxy]sulfonylbenzoate is CCOC(=O)c1ccccc1S(=O)(=O)Oc1cc(Cl)ccc1-c1nc2ncccc2o1.
What is the InChIKey of ethyl 2-[5-chloro-2-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenoxy]sulfonylbenzoate?
The InChIKey is QNNFCCAJWANTBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H15ClN2O6S/c1-2-28-21(25)15-6-3-4-8-18(15)31(26,27)30-17-12-13(22)9-10-14(17)20-24-19-16(29-20)7-5-11-23-19/h3-12H,2H2,1H3.
What are the key properties of ethyl 2-[5-chloro-2-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenoxy]sulfonylbenzoate?
ethyl 2-[5-chloro-2-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenoxy]sulfonylbenzoate has a molecular weight of 458.88 g/mol, XLogP of 4.49, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[5-chloro-2-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenoxy]sulfonylbenzoate is sourced from PubChem (CID 83282449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).