About [2-(5-ethylsulfonyl-1,3-benzoxazol-2-yl)phenyl] 2,3-dichlorobenzenesulfonate
[2-(5-ethylsulfonyl-1,3-benzoxazol-2-yl)phenyl] 2,3-dichlorobenzenesulfonate (PubChem CID 83282588) has the molecular formula C21H15Cl2NO6S2
and a molecular weight of 512.39 g/mol. Its IUPAC name is [2-(5-ethylsulfonyl-1,3-benzoxazol-2-yl)phenyl] 2,3-dichlorobenzenesulfonate.
Molecular Properties
| Compound Name | [2-(5-ethylsulfonyl-1,3-benzoxazol-2-yl)phenyl] 2,3-dichlorobenzenesulfonate |
| PubChem CID | 83282588 |
| Molecular Formula | C21H15Cl2NO6S2 |
| Molecular Weight | 512.39 g/mol |
| Exact Mass | 510.97 |
| IUPAC Name | [2-(5-ethylsulfonyl-1,3-benzoxazol-2-yl)phenyl] 2,3-dichlorobenzenesulfonate |
| SMILES | CCS(=O)(=O)c1ccc2oc(-c3ccccc3OS(=O)(=O)c3cccc(Cl)c3Cl)nc2c1 |
| InChI | InChI=1S/C21H15Cl2NO6S2/c1-2-31(25,26)13-10-11-18-16(12-13)24-21(29-18)14-6-3-4-8-17(14)30-32(27,28)19-9-5-7-15(22)20(19)23/h3-12H,2H2,1H3 |
| InChIKey | CTWWGKBYIFRXMF-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 103.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 512.39 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [2-(5-ethylsulfonyl-1,3-benzoxazol-2-yl)phenyl] 2,3-dichlorobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(5-ethylsulfonyl-1,3-benzoxazol-2-yl)phenyl] 2,3-dichlorobenzenesulfonate?
The IUPAC name of [2-(5-ethylsulfonyl-1,3-benzoxazol-2-yl)phenyl] 2,3-dichlorobenzenesulfonate (CID 83282588) is [2-(5-ethylsulfonyl-1,3-benzoxazol-2-yl)phenyl] 2,3-dichlorobenzenesulfonate.
What is the SMILES notation for [2-(5-ethylsulfonyl-1,3-benzoxazol-2-yl)phenyl] 2,3-dichlorobenzenesulfonate?
The canonical SMILES for [2-(5-ethylsulfonyl-1,3-benzoxazol-2-yl)phenyl] 2,3-dichlorobenzenesulfonate is CCS(=O)(=O)c1ccc2oc(-c3ccccc3OS(=O)(=O)c3cccc(Cl)c3Cl)nc2c1.
What is the InChIKey of [2-(5-ethylsulfonyl-1,3-benzoxazol-2-yl)phenyl] 2,3-dichlorobenzenesulfonate?
The InChIKey is CTWWGKBYIFRXMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H15Cl2NO6S2/c1-2-31(25,26)13-10-11-18-16(12-13)24-21(29-18)14-6-3-4-8-17(14)30-32(27,28)19-9-5-7-15(22)20(19)23/h3-12H,2H2,1H3.
What are the key properties of [2-(5-ethylsulfonyl-1,3-benzoxazol-2-yl)phenyl] 2,3-dichlorobenzenesulfonate?
[2-(5-ethylsulfonyl-1,3-benzoxazol-2-yl)phenyl] 2,3-dichlorobenzenesulfonate has a molecular weight of 512.39 g/mol, XLogP of 5.36, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(5-ethylsulfonyl-1,3-benzoxazol-2-yl)phenyl] 2,3-dichlorobenzenesulfonate is sourced from PubChem (CID 83282588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).