C20H21Cl2N3O2 — CID 83284107
3-(2-benzyl-5,6-dichlorobenzimidazol-1-yl)-N-(2-methoxyethyl)propanamide (PubChem CID 83284107) has the molecular formula C20H21Cl2N3O2 and a molecular weight of 406.31 g/mol. Its IUPAC name is 3-(2-benzyl-5,6-dichlorobenzimidazol-1-yl)-N-(2-methoxyethyl)propanamide.
| Compound Name | 3-(2-benzyl-5,6-dichlorobenzimidazol-1-yl)-N-(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 83284107 |
| Molecular Formula | C20H21Cl2N3O2 |
| Molecular Weight | 406.31 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | 3-(2-benzyl-5,6-dichlorobenzimidazol-1-yl)-N-(2-methoxyethyl)propanamide |
| SMILES | COCCNC(=O)CCn1c(Cc2ccccc2)nc2cc(Cl)c(Cl)cc21 |
| InChI | InChI=1S/C20H21Cl2N3O2/c1-27-10-8-23-20(26)7-9-25-18-13-16(22)15(21)12-17(18)24-19(25)11-14-5-3-2-4-6-14/h2-6,12-13H,7-11H2,1H3,(H,23,26) |
| InChIKey | YCLAUOUBBDMSML-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.31 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|