C29H36N2O3 — CID 83285067
3-cyclohexyl-3-[1-[(4-methoxyphenyl)methyl]indol-3-yl]-1-morpholin-4-ylpropan-1-one (PubChem CID 83285067) has the molecular formula C29H36N2O3 and a molecular weight of 460.62 g/mol. Its IUPAC name is 3-cyclohexyl-3-[1-[(4-methoxyphenyl)methyl]indol-3-yl]-1-morpholin-4-ylpropan-1-one.
| Compound Name | 3-cyclohexyl-3-[1-[(4-methoxyphenyl)methyl]indol-3-yl]-1-morpholin-4-ylpropan-1-one |
|---|---|
| PubChem CID | 83285067 |
| Molecular Formula | C29H36N2O3 |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.27 |
| IUPAC Name | 3-cyclohexyl-3-[1-[(4-methoxyphenyl)methyl]indol-3-yl]-1-morpholin-4-ylpropan-1-one |
| SMILES | COc1ccc(Cn2cc(C(CC(=O)N3CCOCC3)C3CCCCC3)c3ccccc32)cc1 |
| InChI | InChI=1S/C29H36N2O3/c1-33-24-13-11-22(12-14-24)20-31-21-27(25-9-5-6-10-28(25)31)26(23-7-3-2-4-8-23)19-29(32)30-15-17-34-18-16-30/h5-6,9-14,21,23,26H,2-4,7-8,15-20H2,1H3 |
| InChIKey | XKOWDHBQOMQFSL-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 43.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |