C19H13ClN2O5S — CID 83285585
[5-chloro-2-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl] 2-methoxybenzenesulfonate (PubChem CID 83285585) has the molecular formula C19H13ClN2O5S and a molecular weight of 416.84 g/mol. Its IUPAC name is [5-chloro-2-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl] 2-methoxybenzenesulfonate.
| Compound Name | [5-chloro-2-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl] 2-methoxybenzenesulfonate |
|---|---|
| PubChem CID | 83285585 |
| Molecular Formula | C19H13ClN2O5S |
| Molecular Weight | 416.84 g/mol |
| Exact Mass | 416.02 |
| IUPAC Name | [5-chloro-2-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl] 2-methoxybenzenesulfonate |
| SMILES | COc1ccccc1S(=O)(=O)Oc1cc(Cl)ccc1-c1nc2ncccc2o1 |
| InChI | InChI=1S/C19H13ClN2O5S/c1-25-14-5-2-3-7-17(14)28(23,24)27-16-11-12(20)8-9-13(16)19-22-18-15(26-19)6-4-10-21-18/h2-11H,1H3 |
| InChIKey | XJWLQKKLTLIKSC-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 91.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.84 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|