C19H12Cl2N2O4S — CID 83285788
[4-methyl-2-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl] 2,3-dichlorobenzenesulfonate (PubChem CID 83285788) has the molecular formula C19H12Cl2N2O4S and a molecular weight of 435.29 g/mol. Its IUPAC name is [4-methyl-2-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl] 2,3-dichlorobenzenesulfonate.
| Compound Name | [4-methyl-2-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl] 2,3-dichlorobenzenesulfonate |
|---|---|
| PubChem CID | 83285788 |
| Molecular Formula | C19H12Cl2N2O4S |
| Molecular Weight | 435.29 g/mol |
| Exact Mass | 433.99 |
| IUPAC Name | [4-methyl-2-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl] 2,3-dichlorobenzenesulfonate |
| SMILES | Cc1ccc(OS(=O)(=O)c2cccc(Cl)c2Cl)c(-c2nc3ncccc3o2)c1 |
| InChI | InChI=1S/C19H12Cl2N2O4S/c1-11-7-8-14(27-28(24,25)16-6-2-4-13(20)17(16)21)12(10-11)19-23-18-15(26-19)5-3-9-22-18/h2-10H,1H3 |
| InChIKey | XLCJZOXDYVWGOR-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 82.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.29 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|