About [4-[6-(3,4-difluorophenoxy)pyrimidin-4-yl]piperazin-1-yl]-(2-methylphenyl)methanone
[4-[6-(3,4-difluorophenoxy)pyrimidin-4-yl]piperazin-1-yl]-(2-methylphenyl)methanone (PubChem CID 83289521) has the molecular formula C22H20F2N4O2
and a molecular weight of 410.42 g/mol. Its IUPAC name is [4-[6-(3,4-difluorophenoxy)pyrimidin-4-yl]piperazin-1-yl]-(2-methylphenyl)methanone.
Molecular Properties
| Compound Name | [4-[6-(3,4-difluorophenoxy)pyrimidin-4-yl]piperazin-1-yl]-(2-methylphenyl)methanone |
| PubChem CID | 83289521 |
| Molecular Formula | C22H20F2N4O2 |
| Molecular Weight | 410.42 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | [4-[6-(3,4-difluorophenoxy)pyrimidin-4-yl]piperazin-1-yl]-(2-methylphenyl)methanone |
| SMILES | Cc1ccccc1C(=O)N1CCN(c2cc(Oc3ccc(F)c(F)c3)ncn2)CC1 |
| InChI | InChI=1S/C22H20F2N4O2/c1-15-4-2-3-5-17(15)22(29)28-10-8-27(9-11-28)20-13-21(26-14-25-20)30-16-6-7-18(23)19(24)12-16/h2-7,12-14H,8-11H2,1H3 |
| InChIKey | QTQOWPDGOJROEF-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.42 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [4-[6-(3,4-difluorophenoxy)pyrimidin-4-yl]piperazin-1-yl]-(2-methylphenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[6-(3,4-difluorophenoxy)pyrimidin-4-yl]piperazin-1-yl]-(2-methylphenyl)methanone?
The IUPAC name of [4-[6-(3,4-difluorophenoxy)pyrimidin-4-yl]piperazin-1-yl]-(2-methylphenyl)methanone (CID 83289521) is [4-[6-(3,4-difluorophenoxy)pyrimidin-4-yl]piperazin-1-yl]-(2-methylphenyl)methanone.
What is the SMILES notation for [4-[6-(3,4-difluorophenoxy)pyrimidin-4-yl]piperazin-1-yl]-(2-methylphenyl)methanone?
The canonical SMILES for [4-[6-(3,4-difluorophenoxy)pyrimidin-4-yl]piperazin-1-yl]-(2-methylphenyl)methanone is Cc1ccccc1C(=O)N1CCN(c2cc(Oc3ccc(F)c(F)c3)ncn2)CC1.
What is the InChIKey of [4-[6-(3,4-difluorophenoxy)pyrimidin-4-yl]piperazin-1-yl]-(2-methylphenyl)methanone?
The InChIKey is QTQOWPDGOJROEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20F2N4O2/c1-15-4-2-3-5-17(15)22(29)28-10-8-27(9-11-28)20-13-21(26-14-25-20)30-16-6-7-18(23)19(24)12-16/h2-7,12-14H,8-11H2,1H3.
What are the key properties of [4-[6-(3,4-difluorophenoxy)pyrimidin-4-yl]piperazin-1-yl]-(2-methylphenyl)methanone?
[4-[6-(3,4-difluorophenoxy)pyrimidin-4-yl]piperazin-1-yl]-(2-methylphenyl)methanone has a molecular weight of 410.42 g/mol, XLogP of 3.82, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[6-(3,4-difluorophenoxy)pyrimidin-4-yl]piperazin-1-yl]-(2-methylphenyl)methanone is sourced from PubChem (CID 83289521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).