About [5-chloro-2-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl] 2-(trifluoromethoxy)benzenesulfonate
[5-chloro-2-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl] 2-(trifluoromethoxy)benzenesulfonate (PubChem CID 83290166) has the molecular formula C19H10ClF3N2O5S
and a molecular weight of 470.81 g/mol. Its IUPAC name is [5-chloro-2-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl] 2-(trifluoromethoxy)benzenesulfonate.
Molecular Properties
| Compound Name | [5-chloro-2-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl] 2-(trifluoromethoxy)benzenesulfonate |
| PubChem CID | 83290166 |
| Molecular Formula | C19H10ClF3N2O5S |
| Molecular Weight | 470.81 g/mol |
| Exact Mass | 470.00 |
| IUPAC Name | [5-chloro-2-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl] 2-(trifluoromethoxy)benzenesulfonate |
| SMILES | O=S(=O)(Oc1cc(Cl)ccc1-c1nc2ncccc2o1)c1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C19H10ClF3N2O5S/c20-11-7-8-12(18-25-17-14(28-18)5-3-9-24-17)15(10-11)30-31(26,27)16-6-2-1-4-13(16)29-19(21,22)23/h1-10H |
| InChIKey | WAJXXGLBSULPEQ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 91.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 470.81 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [5-chloro-2-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl] 2-(trifluoromethoxy)benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-chloro-2-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl] 2-(trifluoromethoxy)benzenesulfonate?
The IUPAC name of [5-chloro-2-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl] 2-(trifluoromethoxy)benzenesulfonate (CID 83290166) is [5-chloro-2-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl] 2-(trifluoromethoxy)benzenesulfonate.
What is the SMILES notation for [5-chloro-2-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl] 2-(trifluoromethoxy)benzenesulfonate?
The canonical SMILES for [5-chloro-2-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl] 2-(trifluoromethoxy)benzenesulfonate is O=S(=O)(Oc1cc(Cl)ccc1-c1nc2ncccc2o1)c1ccccc1OC(F)(F)F.
What is the InChIKey of [5-chloro-2-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl] 2-(trifluoromethoxy)benzenesulfonate?
The InChIKey is WAJXXGLBSULPEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H10ClF3N2O5S/c20-11-7-8-12(18-25-17-14(28-18)5-3-9-24-17)15(10-11)30-31(26,27)16-6-2-1-4-13(16)29-19(21,22)23/h1-10H.
What are the key properties of [5-chloro-2-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl] 2-(trifluoromethoxy)benzenesulfonate?
[5-chloro-2-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl] 2-(trifluoromethoxy)benzenesulfonate has a molecular weight of 470.81 g/mol, XLogP of 5.21, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [5-chloro-2-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl] 2-(trifluoromethoxy)benzenesulfonate is sourced from PubChem (CID 83290166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).