About [2-(1,3-benzoxazol-2-yl)-5-chlorophenyl] 2-(trifluoromethoxy)benzenesulfonate
[2-(1,3-benzoxazol-2-yl)-5-chlorophenyl] 2-(trifluoromethoxy)benzenesulfonate (PubChem CID 83290167) has the molecular formula C20H11ClF3NO5S
and a molecular weight of 469.82 g/mol. Its IUPAC name is [2-(1,3-benzoxazol-2-yl)-5-chlorophenyl] 2-(trifluoromethoxy)benzenesulfonate.
Molecular Properties
| Compound Name | [2-(1,3-benzoxazol-2-yl)-5-chlorophenyl] 2-(trifluoromethoxy)benzenesulfonate |
| PubChem CID | 83290167 |
| Molecular Formula | C20H11ClF3NO5S |
| Molecular Weight | 469.82 g/mol |
| Exact Mass | 469.00 |
| IUPAC Name | [2-(1,3-benzoxazol-2-yl)-5-chlorophenyl] 2-(trifluoromethoxy)benzenesulfonate |
| SMILES | O=S(=O)(Oc1cc(Cl)ccc1-c1nc2ccccc2o1)c1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C20H11ClF3NO5S/c21-12-9-10-13(19-25-14-5-1-2-6-15(14)28-19)17(11-12)30-31(26,27)18-8-4-3-7-16(18)29-20(22,23)24/h1-11H |
| InChIKey | WOMUXDPMSJFYGY-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 78.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 469.82 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [2-(1,3-benzoxazol-2-yl)-5-chlorophenyl] 2-(trifluoromethoxy)benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(1,3-benzoxazol-2-yl)-5-chlorophenyl] 2-(trifluoromethoxy)benzenesulfonate?
The IUPAC name of [2-(1,3-benzoxazol-2-yl)-5-chlorophenyl] 2-(trifluoromethoxy)benzenesulfonate (CID 83290167) is [2-(1,3-benzoxazol-2-yl)-5-chlorophenyl] 2-(trifluoromethoxy)benzenesulfonate.
What is the SMILES notation for [2-(1,3-benzoxazol-2-yl)-5-chlorophenyl] 2-(trifluoromethoxy)benzenesulfonate?
The canonical SMILES for [2-(1,3-benzoxazol-2-yl)-5-chlorophenyl] 2-(trifluoromethoxy)benzenesulfonate is O=S(=O)(Oc1cc(Cl)ccc1-c1nc2ccccc2o1)c1ccccc1OC(F)(F)F.
What is the InChIKey of [2-(1,3-benzoxazol-2-yl)-5-chlorophenyl] 2-(trifluoromethoxy)benzenesulfonate?
The InChIKey is WOMUXDPMSJFYGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H11ClF3NO5S/c21-12-9-10-13(19-25-14-5-1-2-6-15(14)28-19)17(11-12)30-31(26,27)18-8-4-3-7-16(18)29-20(22,23)24/h1-11H.
What are the key properties of [2-(1,3-benzoxazol-2-yl)-5-chlorophenyl] 2-(trifluoromethoxy)benzenesulfonate?
[2-(1,3-benzoxazol-2-yl)-5-chlorophenyl] 2-(trifluoromethoxy)benzenesulfonate has a molecular weight of 469.82 g/mol, XLogP of 5.81, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(1,3-benzoxazol-2-yl)-5-chlorophenyl] 2-(trifluoromethoxy)benzenesulfonate is sourced from PubChem (CID 83290167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).