About 5-cyclopentyl-4,6-dihydrothieno[2,3-c]pyrrole-2-carboxylic acid
5-cyclopentyl-4,6-dihydrothieno[2,3-c]pyrrole-2-carboxylic acid (PubChem CID 83290816) has the molecular formula C12H15NO2S
and a molecular weight of 237.32 g/mol. Its IUPAC name is 5-cyclopentyl-4,6-dihydrothieno[2,3-c]pyrrole-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-cyclopentyl-4,6-dihydrothieno[2,3-c]pyrrole-2-carboxylic acid |
| PubChem CID | 83290816 |
| Molecular Formula | C12H15NO2S |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | 5-cyclopentyl-4,6-dihydrothieno[2,3-c]pyrrole-2-carboxylic acid |
| SMILES | O=C(O)c1cc2c(s1)CN(C1CCCC1)C2 |
| InChI | InChI=1S/C12H15NO2S/c14-12(15)10-5-8-6-13(7-11(8)16-10)9-3-1-2-4-9/h5,9H,1-4,6-7H2,(H,14,15) |
| InChIKey | SRQGZXCRGDNGMW-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-cyclopentyl-4,6-dihydrothieno[2,3-c]pyrrole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclopentyl-4,6-dihydrothieno[2,3-c]pyrrole-2-carboxylic acid?
The IUPAC name of 5-cyclopentyl-4,6-dihydrothieno[2,3-c]pyrrole-2-carboxylic acid (CID 83290816) is 5-cyclopentyl-4,6-dihydrothieno[2,3-c]pyrrole-2-carboxylic acid.
What is the SMILES notation for 5-cyclopentyl-4,6-dihydrothieno[2,3-c]pyrrole-2-carboxylic acid?
The canonical SMILES for 5-cyclopentyl-4,6-dihydrothieno[2,3-c]pyrrole-2-carboxylic acid is O=C(O)c1cc2c(s1)CN(C1CCCC1)C2.
What is the InChIKey of 5-cyclopentyl-4,6-dihydrothieno[2,3-c]pyrrole-2-carboxylic acid?
The InChIKey is SRQGZXCRGDNGMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO2S/c14-12(15)10-5-8-6-13(7-11(8)16-10)9-3-1-2-4-9/h5,9H,1-4,6-7H2,(H,14,15).
What are the key properties of 5-cyclopentyl-4,6-dihydrothieno[2,3-c]pyrrole-2-carboxylic acid?
5-cyclopentyl-4,6-dihydrothieno[2,3-c]pyrrole-2-carboxylic acid has a molecular weight of 237.32 g/mol, XLogP of 2.70, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclopentyl-4,6-dihydrothieno[2,3-c]pyrrole-2-carboxylic acid is sourced from PubChem (CID 83290816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).