About 2-(2-benzyl-4-methyl-1,3-thiazol-5-yl)ethanol
2-(2-benzyl-4-methyl-1,3-thiazol-5-yl)ethanol (PubChem CID 83292082) has the molecular formula C13H15NOS
and a molecular weight of 233.34 g/mol. Its IUPAC name is 2-(2-benzyl-4-methyl-1,3-thiazol-5-yl)ethanol.
Molecular Properties
| Compound Name | 2-(2-benzyl-4-methyl-1,3-thiazol-5-yl)ethanol |
| PubChem CID | 83292082 |
| Molecular Formula | C13H15NOS |
| Molecular Weight | 233.34 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | 2-(2-benzyl-4-methyl-1,3-thiazol-5-yl)ethanol |
| SMILES | Cc1nc(Cc2ccccc2)sc1CCO |
| InChI | InChI=1S/C13H15NOS/c1-10-12(7-8-15)16-13(14-10)9-11-5-3-2-4-6-11/h2-6,15H,7-9H2,1H3 |
| InChIKey | CTILWSYBOVXULK-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.34 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2-benzyl-4-methyl-1,3-thiazol-5-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-benzyl-4-methyl-1,3-thiazol-5-yl)ethanol?
The IUPAC name of 2-(2-benzyl-4-methyl-1,3-thiazol-5-yl)ethanol (CID 83292082) is 2-(2-benzyl-4-methyl-1,3-thiazol-5-yl)ethanol.
What is the SMILES notation for 2-(2-benzyl-4-methyl-1,3-thiazol-5-yl)ethanol?
The canonical SMILES for 2-(2-benzyl-4-methyl-1,3-thiazol-5-yl)ethanol is Cc1nc(Cc2ccccc2)sc1CCO.
What is the InChIKey of 2-(2-benzyl-4-methyl-1,3-thiazol-5-yl)ethanol?
The InChIKey is CTILWSYBOVXULK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NOS/c1-10-12(7-8-15)16-13(14-10)9-11-5-3-2-4-6-11/h2-6,15H,7-9H2,1H3.
What are the key properties of 2-(2-benzyl-4-methyl-1,3-thiazol-5-yl)ethanol?
2-(2-benzyl-4-methyl-1,3-thiazol-5-yl)ethanol has a molecular weight of 233.34 g/mol, XLogP of 2.58, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-benzyl-4-methyl-1,3-thiazol-5-yl)ethanol is sourced from PubChem (CID 83292082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).