About N-(2-chlorophenyl)-N'-(cyclopentylideneamino)butanediamide
N-(2-chlorophenyl)-N'-(cyclopentylideneamino)butanediamide (PubChem CID 833088) has the molecular formula C15H18ClN3O2
and a molecular weight of 307.78 g/mol. Its IUPAC name is N-(2-chlorophenyl)-N'-(cyclopentylideneamino)butanediamide.
Molecular Properties
| Compound Name | N-(2-chlorophenyl)-N'-(cyclopentylideneamino)butanediamide |
| PubChem CID | 833088 |
| Molecular Formula | C15H18ClN3O2 |
| Molecular Weight | 307.78 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | N-(2-chlorophenyl)-N'-(cyclopentylideneamino)butanediamide |
| SMILES | O=C(CCC(=O)Nc1ccccc1Cl)NN=C1CCCC1 |
| InChI | InChI=1S/C15H18ClN3O2/c16-12-7-3-4-8-13(12)17-14(20)9-10-15(21)19-18-11-5-1-2-6-11/h3-4,7-8H,1-2,5-6,9-10H2,(H,17,20)(H,19,21) |
| InChIKey | XMWFIGAJLBTFRR-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.78 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(2-chlorophenyl)-N'-(cyclopentylideneamino)butanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-chlorophenyl)-N'-(cyclopentylideneamino)butanediamide?
The IUPAC name of N-(2-chlorophenyl)-N'-(cyclopentylideneamino)butanediamide (CID 833088) is N-(2-chlorophenyl)-N'-(cyclopentylideneamino)butanediamide.
What is the SMILES notation for N-(2-chlorophenyl)-N'-(cyclopentylideneamino)butanediamide?
The canonical SMILES for N-(2-chlorophenyl)-N'-(cyclopentylideneamino)butanediamide is O=C(CCC(=O)Nc1ccccc1Cl)NN=C1CCCC1.
What is the InChIKey of N-(2-chlorophenyl)-N'-(cyclopentylideneamino)butanediamide?
The InChIKey is XMWFIGAJLBTFRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18ClN3O2/c16-12-7-3-4-8-13(12)17-14(20)9-10-15(21)19-18-11-5-1-2-6-11/h3-4,7-8H,1-2,5-6,9-10H2,(H,17,20)(H,19,21).
What are the key properties of N-(2-chlorophenyl)-N'-(cyclopentylideneamino)butanediamide?
N-(2-chlorophenyl)-N'-(cyclopentylideneamino)butanediamide has a molecular weight of 307.78 g/mol, XLogP of 3.10, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-chlorophenyl)-N'-(cyclopentylideneamino)butanediamide is sourced from PubChem (CID 833088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).