About cis-(1R,2S)-2-[(thiophene-2-carbonylamino)carbamoyl]cyclohexane-1-carboxylic acid
cis-(1R,2S)-2-[(thiophene-2-carbonylamino)carbamoyl]cyclohexane-1-carboxylic acid (PubChem CID 833312) has the molecular formula C13H16N2O4S
and a molecular weight of 296.35 g/mol. Its IUPAC name is cis-(1R,2S)-2-[(thiophene-2-carbonylamino)carbamoyl]cyclohexane-1-carboxylic acid.
Molecular Properties
| Compound Name | cis-(1R,2S)-2-[(thiophene-2-carbonylamino)carbamoyl]cyclohexane-1-carboxylic acid |
| PubChem CID | 833312 |
| Molecular Formula | C13H16N2O4S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | cis-(1R,2S)-2-[(thiophene-2-carbonylamino)carbamoyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(NNC(=O)[C@H]1CCCC[C@H]1C(=O)O)c1cccs1 |
| InChI | InChI=1S/C13H16N2O4S/c16-11(8-4-1-2-5-9(8)13(18)19)14-15-12(17)10-6-3-7-20-10/h3,6-9H,1-2,4-5H2,(H,14,16)(H,15,17)(H,18,19)/t8-,9+/m0/s1 |
| InChIKey | DBRWFJAGJJIIRW-DTWKUNHWSA-N |
| XLogP | 1.40 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze cis-(1R,2S)-2-[(thiophene-2-carbonylamino)carbamoyl]cyclohexane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1R,2S)-2-[(thiophene-2-carbonylamino)carbamoyl]cyclohexane-1-carboxylic acid?
The IUPAC name of cis-(1R,2S)-2-[(thiophene-2-carbonylamino)carbamoyl]cyclohexane-1-carboxylic acid (CID 833312) is cis-(1R,2S)-2-[(thiophene-2-carbonylamino)carbamoyl]cyclohexane-1-carboxylic acid.
What is the SMILES notation for cis-(1R,2S)-2-[(thiophene-2-carbonylamino)carbamoyl]cyclohexane-1-carboxylic acid?
The canonical SMILES for cis-(1R,2S)-2-[(thiophene-2-carbonylamino)carbamoyl]cyclohexane-1-carboxylic acid is O=C(NNC(=O)[C@H]1CCCC[C@H]1C(=O)O)c1cccs1.
What is the InChIKey of cis-(1R,2S)-2-[(thiophene-2-carbonylamino)carbamoyl]cyclohexane-1-carboxylic acid?
The InChIKey is DBRWFJAGJJIIRW-DTWKUNHWSA-N. The full InChI is InChI=1S/C13H16N2O4S/c16-11(8-4-1-2-5-9(8)13(18)19)14-15-12(17)10-6-3-7-20-10/h3,6-9H,1-2,4-5H2,(H,14,16)(H,15,17)(H,18,19)/t8-,9+/m0/s1.
What are the key properties of cis-(1R,2S)-2-[(thiophene-2-carbonylamino)carbamoyl]cyclohexane-1-carboxylic acid?
cis-(1R,2S)-2-[(thiophene-2-carbonylamino)carbamoyl]cyclohexane-1-carboxylic acid has a molecular weight of 296.35 g/mol, XLogP of 1.40, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1R,2S)-2-[(thiophene-2-carbonylamino)carbamoyl]cyclohexane-1-carboxylic acid is sourced from PubChem (CID 833312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).