C12H14ClN — CID 83358632
8-chloro-1-cyclopropyl-1,2,3,4-tetrahydroisoquinoline (PubChem CID 83358632) has the molecular formula C12H14ClN and a molecular weight of 207.70 g/mol. Its IUPAC name is 8-chloro-1-cyclopropyl-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 8-chloro-1-cyclopropyl-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 83358632 |
| Molecular Formula | C12H14ClN |
| Molecular Weight | 207.70 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | 8-chloro-1-cyclopropyl-1,2,3,4-tetrahydroisoquinoline |
| SMILES | Clc1cccc2c1C(C1CC1)NCC2 |
| InChI | InChI=1S/C12H14ClN/c13-10-3-1-2-8-6-7-14-12(11(8)10)9-4-5-9/h1-3,9,12,14H,4-7H2 |
| InChIKey | CUUAUEXKPRANSA-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.70 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |