C13H18N2O — CID 83359300
1-pyrrolidin-2-yl-1,2,3,4-tetrahydroisoquinolin-7-ol (PubChem CID 83359300) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is 1-pyrrolidin-2-yl-1,2,3,4-tetrahydroisoquinolin-7-ol.
| Compound Name | 1-pyrrolidin-2-yl-1,2,3,4-tetrahydroisoquinolin-7-ol |
|---|---|
| PubChem CID | 83359300 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 1-pyrrolidin-2-yl-1,2,3,4-tetrahydroisoquinolin-7-ol |
| SMILES | Oc1ccc2c(c1)C(C1CCCN1)NCC2 |
| InChI | InChI=1S/C13H18N2O/c16-10-4-3-9-5-7-15-13(11(9)8-10)12-2-1-6-14-12/h3-4,8,12-16H,1-2,5-7H2 |
| InChIKey | MYLFZBJVUQXDSK-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |