C16H17ClN2 — CID 83359935
1-(4-chloro-3-pyridinyl)-7-ethyl-1,2,3,4-tetrahydroisoquinoline (PubChem CID 83359935) has the molecular formula C16H17ClN2 and a molecular weight of 272.78 g/mol. Its IUPAC name is 1-(4-chloro-3-pyridinyl)-7-ethyl-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 1-(4-chloro-3-pyridinyl)-7-ethyl-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 83359935 |
| Molecular Formula | C16H17ClN2 |
| Molecular Weight | 272.78 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 1-(4-chloro-3-pyridinyl)-7-ethyl-1,2,3,4-tetrahydroisoquinoline |
| SMILES | CCc1ccc2c(c1)C(c1cnccc1Cl)NCC2 |
| InChI | InChI=1S/C16H17ClN2/c1-2-11-3-4-12-5-8-19-16(13(12)9-11)14-10-18-7-6-15(14)17/h3-4,6-7,9-10,16,19H,2,5,8H2,1H3 |
| InChIKey | NFHHTUQNIIMYLM-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.78 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |