About 2-(3-methoxyphenyl)-1,3-benzothiazole
2-(3-methoxyphenyl)-1,3-benzothiazole (PubChem CID 833673) has the molecular formula C14H11NOS
and a molecular weight of 241.32 g/mol. Its IUPAC name is 2-(3-methoxyphenyl)-1,3-benzothiazole.
Molecular Properties
| Compound Name | 2-(3-methoxyphenyl)-1,3-benzothiazole |
| PubChem CID | 833673 |
| Molecular Formula | C14H11NOS |
| Molecular Weight | 241.32 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | 2-(3-methoxyphenyl)-1,3-benzothiazole |
| SMILES | COc1cccc(-c2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C14H11NOS/c1-16-11-6-4-5-10(9-11)14-15-12-7-2-3-8-13(12)17-14/h2-9H,1H3 |
| InChIKey | HROHCTACUYNNLZ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.32 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(3-methoxyphenyl)-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methoxyphenyl)-1,3-benzothiazole?
The IUPAC name of 2-(3-methoxyphenyl)-1,3-benzothiazole (CID 833673) is 2-(3-methoxyphenyl)-1,3-benzothiazole.
What is the SMILES notation for 2-(3-methoxyphenyl)-1,3-benzothiazole?
The canonical SMILES for 2-(3-methoxyphenyl)-1,3-benzothiazole is COc1cccc(-c2nc3ccccc3s2)c1.
What is the InChIKey of 2-(3-methoxyphenyl)-1,3-benzothiazole?
The InChIKey is HROHCTACUYNNLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11NOS/c1-16-11-6-4-5-10(9-11)14-15-12-7-2-3-8-13(12)17-14/h2-9H,1H3.
What are the key properties of 2-(3-methoxyphenyl)-1,3-benzothiazole?
2-(3-methoxyphenyl)-1,3-benzothiazole has a molecular weight of 241.32 g/mol, XLogP of 3.97, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methoxyphenyl)-1,3-benzothiazole is sourced from PubChem (CID 833673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).